C21H31FO3 — CID 118593949
2-[4-(4-ethoxycyclohexyl)phenyl]-5-fluoro-5-propyl-1,3-dioxane (PubChem CID 118593949) has the molecular formula C21H31FO3 and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[4-(4-ethoxycyclohexyl)phenyl]-5-fluoro-5-propyl-1,3-dioxane.
| Compound Name | 2-[4-(4-ethoxycyclohexyl)phenyl]-5-fluoro-5-propyl-1,3-dioxane |
|---|---|
| PubChem CID | 118593949 |
| Molecular Formula | C21H31FO3 |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | 2-[4-(4-ethoxycyclohexyl)phenyl]-5-fluoro-5-propyl-1,3-dioxane |
| SMILES | CCCC1(F)COC(c2ccc(C3CCC(OCC)CC3)cc2)OC1 |
| InChI | InChI=1S/C21H31FO3/c1-3-13-21(22)14-24-20(25-15-21)18-7-5-16(6-8-18)17-9-11-19(12-10-17)23-4-2/h5-8,17,19-20H,3-4,9-15H2,1-2H3 |
| InChIKey | NNTUOBJEAKKZPM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |