C22H30F2O5 — CID 118594081
[2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-propyloxane-3-carboxylate (PubChem CID 118594081) has the molecular formula C22H30F2O5 and a molecular weight of 412.47 g/mol. Its IUPAC name is [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-propyloxane-3-carboxylate.
| Compound Name | [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-propyloxane-3-carboxylate |
|---|---|
| PubChem CID | 118594081 |
| Molecular Formula | C22H30F2O5 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-propyloxane-3-carboxylate |
| SMILES | CCCC1CCC(C(=O)Oc2ccc(C3OCC(F)(CCC)CO3)cc2F)CO1 |
| InChI | InChI=1S/C22H30F2O5/c1-3-5-17-8-6-16(12-26-17)20(25)29-19-9-7-15(11-18(19)23)21-27-13-22(24,10-4-2)14-28-21/h7,9,11,16-17,21H,3-6,8,10,12-14H2,1-2H3 |
| InChIKey | QYFINFKRGHCKHR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|