C27H38F2O5 — CID 118594208
[2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-(4-ethylcyclohexyl)oxane-3-carboxylate (PubChem CID 118594208) has the molecular formula C27H38F2O5 and a molecular weight of 480.59 g/mol. Its IUPAC name is [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-(4-ethylcyclohexyl)oxane-3-carboxylate.
| Compound Name | [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-(4-ethylcyclohexyl)oxane-3-carboxylate |
|---|---|
| PubChem CID | 118594208 |
| Molecular Formula | C27H38F2O5 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [2-fluoro-4-(5-fluoro-5-propyl-1,3-dioxan-2-yl)phenyl] 6-(4-ethylcyclohexyl)oxane-3-carboxylate |
| SMILES | CCCC1(F)COC(c2ccc(OC(=O)C3CCC(C4CCC(CC)CC4)OC3)c(F)c2)OC1 |
| InChI | InChI=1S/C27H38F2O5/c1-3-13-27(29)16-32-26(33-17-27)20-9-12-24(22(28)14-20)34-25(30)21-10-11-23(31-15-21)19-7-5-18(4-2)6-8-19/h9,12,14,18-19,21,23,26H,3-8,10-11,13,15-17H2,1-2H3 |
| InChIKey | RQDJZWDOKLPLNH-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|