C25H31BrN8O2 — CID 118595043
(1R,2S,3R,5R)-3-(6-aminopurin-9-yl)-5-[[[3-[2-(6-bromo-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol (PubChem CID 118595043) has the molecular formula C25H31BrN8O2 and a molecular weight of 555.48 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(6-aminopurin-9-yl)-5-[[[3-[2-(6-bromo-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(6-aminopurin-9-yl)-5-[[[3-[2-(6-bromo-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 118595043 |
| Molecular Formula | C25H31BrN8O2 |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | (1R,2S,3R,5R)-3-(6-aminopurin-9-yl)-5-[[[3-[2-(6-bromo-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]cyclopentane-1,2-diol |
| SMILES | CN(C[C@H]1C[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCc2nc3ccc(Br)cc3[nH]2)C1 |
| InChI | InChI=1S/C25H31BrN8O2/c1-33(16-6-13(7-16)2-5-20-31-17-4-3-15(26)9-18(17)32-20)10-14-8-19(23(36)22(14)35)34-12-30-21-24(27)28-11-29-25(21)34/h3-4,9,11-14,16,19,22-23,35-36H,2,5-8,10H2,1H3,(H,31,32)(H2,27,28,29)/t13?,14-,16?,19-,22-,23+/m1/s1 |
| InChIKey | CDXASLSBJPSTEP-KNSBVHEFSA-N |
| XLogP | 2.67 |
| TPSA | 142.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |