C31H42N6O2 — CID 118280951
(1S,2R,3R,5R)-3-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol (PubChem CID 118280951) has the molecular formula C31H42N6O2 and a molecular weight of 530.72 g/mol. Its IUPAC name is (1S,2R,3R,5R)-3-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3R,5R)-3-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 118280951 |
| Molecular Formula | C31H42N6O2 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 530.34 |
| IUPAC Name | (1S,2R,3R,5R)-3-[[[3-[2-(6-tert-butyl-1H-benzimidazol-2-yl)ethyl]cyclobutyl]-methylamino]methyl]-5-(4-methylpyrrolo[2,3-d]pyrimidin-7-yl)cyclopentane-1,2-diol |
| SMILES | Cc1ncnc2c1ccn2[C@@H]1C[C@H](CN(C)C2CC(CCc3nc4ccc(C(C)(C)C)cc4[nH]3)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C31H42N6O2/c1-18-23-10-11-37(30(23)33-17-32-18)26-14-20(28(38)29(26)39)16-36(5)22-12-19(13-22)6-9-27-34-24-8-7-21(31(2,3)4)15-25(24)35-27/h7-8,10-11,15,17,19-20,22,26,28-29,38-39H,6,9,12-14,16H2,1-5H3,(H,34,35)/t19?,20-,22?,26-,28-,29+/m1/s1 |
| InChIKey | MXBBWLNDVUYPLQ-XVBAASRJSA-N |
| XLogP | 4.54 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |