C27H32F3N7O2 — CID 67775797
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[1-methyl-3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol (PubChem CID 67775797) has the molecular formula C27H32F3N7O2 and a molecular weight of 543.59 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[1-methyl-3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[1-methyl-3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 67775797 |
| Molecular Formula | C27H32F3N7O2 |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.26 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[1-methyl-3-[2-[6-(trifluoromethyl)-1H-benzimidazol-2-yl]ethyl]cyclobutyl]amino]methyl]cyclopentane-1,2-diol |
| SMILES | CC1(NC[C@H]2C[C@@H](n3ccc4c(N)ncnc43)[C@H](O)[C@@H]2O)CC(CCc2nc3ccc(C(F)(F)F)cc3[nH]2)C1 |
| InChI | InChI=1S/C27H32F3N7O2/c1-26(10-14(11-26)2-5-21-35-18-4-3-16(27(28,29)30)9-19(18)36-21)34-12-15-8-20(23(39)22(15)38)37-7-6-17-24(31)32-13-33-25(17)37/h3-4,6-7,9,13-15,20,22-23,34,38-39H,2,5,8,10-12H2,1H3,(H,35,36)(H2,31,32,33)/t14?,15-,20-,22-,23+,26?/m1/s1 |
| InChIKey | BKFYXXXGJKTSDM-UDVZVIPESA-N |
| XLogP | 3.58 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |