C26H31Cl2N7O2 — CID 67775549
(1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]cyclobutyl]methylamino]methyl]cyclopentane-1,2-diol (PubChem CID 67775549) has the molecular formula C26H31Cl2N7O2 and a molecular weight of 544.49 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]cyclobutyl]methylamino]methyl]cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]cyclobutyl]methylamino]methyl]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 67775549 |
| Molecular Formula | C26H31Cl2N7O2 |
| Molecular Weight | 544.49 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | (1R,2S,3R,5R)-3-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-[[[3-[2-(5,6-dichloro-1H-benzimidazol-2-yl)ethyl]cyclobutyl]methylamino]methyl]cyclopentane-1,2-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1C[C@H](CNCC2CC(CCc3nc4cc(Cl)c(Cl)cc4[nH]3)C2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C26H31Cl2N7O2/c27-17-8-19-20(9-18(17)28)34-22(33-19)2-1-13-5-14(6-13)10-30-11-15-7-21(24(37)23(15)36)35-4-3-16-25(29)31-12-32-26(16)35/h3-4,8-9,12-15,21,23-24,30,36-37H,1-2,5-7,10-11H2,(H,33,34)(H2,29,31,32)/t13?,14?,15-,21-,23-,24+/m1/s1 |
| InChIKey | YANJZHCQMYIBCL-XXXYDWDWSA-N |
| XLogP | 3.73 |
| TPSA | 137.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.49 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |