C36H43N7O6 — CID 118597399
tert-butyl 2-[2-(2-aminoanilino)pyrimidin-4-yl]-4-oxo-5-[(2,4,6-trimethoxyphenyl)methyl]spiro[1,6-dihydropyrrolo[3,2-c]pyridine-7,3'-piperidine]-1'-carboxylate (PubChem CID 118597399) has the molecular formula C36H43N7O6 and a molecular weight of 669.78 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-aminoanilino)pyrimidin-4-yl]-4-oxo-5-[(2,4,6-trimethoxyphenyl)methyl]spiro[1,6-dihydropyrrolo[3,2-c]pyridine-7,3'-piperidine]-1'-carboxylate.
| Compound Name | tert-butyl 2-[2-(2-aminoanilino)pyrimidin-4-yl]-4-oxo-5-[(2,4,6-trimethoxyphenyl)methyl]spiro[1,6-dihydropyrrolo[3,2-c]pyridine-7,3'-piperidine]-1'-carboxylate |
|---|---|
| PubChem CID | 118597399 |
| Molecular Formula | C36H43N7O6 |
| Molecular Weight | 669.78 g/mol |
| Exact Mass | 669.33 |
| IUPAC Name | tert-butyl 2-[2-(2-aminoanilino)pyrimidin-4-yl]-4-oxo-5-[(2,4,6-trimethoxyphenyl)methyl]spiro[1,6-dihydropyrrolo[3,2-c]pyridine-7,3'-piperidine]-1'-carboxylate |
| SMILES | COc1cc(OC)c(CN2CC3(CCCN(C(=O)OC(C)(C)C)C3)c3[nH]c(-c4ccnc(Nc5ccccc5N)n4)cc3C2=O)c(OC)c1 |
| InChI | InChI=1S/C36H43N7O6/c1-35(2,3)49-34(45)42-15-9-13-36(20-42)21-43(19-24-29(47-5)16-22(46-4)17-30(24)48-6)32(44)23-18-28(39-31(23)36)27-12-14-38-33(41-27)40-26-11-8-7-10-25(26)37/h7-8,10-12,14,16-18,39H,9,13,15,19-21,37H2,1-6H3,(H,38,40,41) |
| InChIKey | FZVKFYOLFQCJCP-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 157.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|