C25H26N4O4S — CID 118597416
N-[2-(2-methoxyethoxy)-5-[4-(3-methyl-5-oxo-1,2,3,4-tetrahydrothieno[3,2-e][1,4]diazepin-7-yl)-2-pyridinyl]phenyl]prop-2-enamide (PubChem CID 118597416) has the molecular formula C25H26N4O4S and a molecular weight of 478.57 g/mol. Its IUPAC name is N-[2-(2-methoxyethoxy)-5-[4-(3-methyl-5-oxo-1,2,3,4-tetrahydrothieno[3,2-e][1,4]diazepin-7-yl)-2-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[2-(2-methoxyethoxy)-5-[4-(3-methyl-5-oxo-1,2,3,4-tetrahydrothieno[3,2-e][1,4]diazepin-7-yl)-2-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 118597416 |
| Molecular Formula | C25H26N4O4S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | N-[2-(2-methoxyethoxy)-5-[4-(3-methyl-5-oxo-1,2,3,4-tetrahydrothieno[3,2-e][1,4]diazepin-7-yl)-2-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cc(-c3cc4c(s3)C(=O)NC(C)CN4)ccn2)ccc1OCCOC |
| InChI | InChI=1S/C25H26N4O4S/c1-4-23(30)29-19-11-16(5-6-21(19)33-10-9-32-3)18-12-17(7-8-26-18)22-13-20-24(34-22)25(31)28-15(2)14-27-20/h4-8,11-13,15,27H,1,9-10,14H2,2-3H3,(H,28,31)(H,29,30) |
| InChIKey | FHRVHZIRJWAISW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|