About dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid
dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid (PubChem CID 118599706) has the molecular formula C17H23O11P
and a molecular weight of 434.33 g/mol. Its IUPAC name is dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid.
Molecular Properties
| Compound Name | dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid |
| PubChem CID | 118599706 |
| Molecular Formula | C17H23O11P |
| Molecular Weight | 434.33 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid |
| SMILES | COC(=O)/C=C(/CC(=O)OC)OP(=O)(OC)OC.O=C(O)COc1ccccc1 |
| InChI | InChI=1S/C9H15O8P.C8H8O3/c1-13-8(10)5-7(6-9(11)14-2)17-18(12,15-3)16-4;9-8(10)6-11-7-4-2-1-3-5-7/h5H,6H2,1-4H3;1-5H,6H2,(H,9,10)/b7-5-; |
| InChIKey | ZEOZJQSMSQJWMZ-YJOCEBFMSA-N |
| XLogP | 2.17 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid?
The IUPAC name of dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid (CID 118599706) is dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid.
What is the SMILES notation for dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid?
The canonical SMILES for dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid is COC(=O)/C=C(/CC(=O)OC)OP(=O)(OC)OC.O=C(O)COc1ccccc1.
What is the InChIKey of dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid?
The InChIKey is ZEOZJQSMSQJWMZ-YJOCEBFMSA-N. The full InChI is InChI=1S/C9H15O8P.C8H8O3/c1-13-8(10)5-7(6-9(11)14-2)17-18(12,15-3)16-4;9-8(10)6-11-7-4-2-1-3-5-7/h5H,6H2,1-4H3;1-5H,6H2,(H,9,10)/b7-5-;.
What are the key properties of dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid?
dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid has a molecular weight of 434.33 g/mol, XLogP of 2.17, 10 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (Z)-3-dimethoxyphosphoryloxypent-2-enedioate;2-phenoxyacetic acid is sourced from PubChem (CID 118599706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).