C29H50F3NO9S — CID 118602783
3-O-(1-ethylcyclopentyl) 5-O-[2-(methanesulfonamido)ethyl] 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate (PubChem CID 118602783) has the molecular formula C29H50F3NO9S and a molecular weight of 645.78 g/mol. Its IUPAC name is 3-O-(1-ethylcyclopentyl) 5-O-[2-(methanesulfonamido)ethyl] 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(1-ethylcyclopentyl) 5-O-[2-(methanesulfonamido)ethyl] 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 118602783 |
| Molecular Formula | C29H50F3NO9S |
| Molecular Weight | 645.78 g/mol |
| Exact Mass | 645.32 |
| IUPAC Name | 3-O-(1-ethylcyclopentyl) 5-O-[2-(methanesulfonamido)ethyl] 1-O-(5,5,5-trifluoro-4-hydroxy-4-methylpentan-2-yl) 1,1,5-trimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC1(OC(=O)C(CC(C)(C)C(=O)OC(C)CC(C)(O)C(F)(F)F)CC(C)(CC)C(=O)OCCNS(C)(=O)=O)CCCC1 |
| InChI | InChI=1S/C29H50F3NO9S/c1-9-26(6,24(36)40-16-15-33-43(8,38)39)19-21(22(34)42-28(10-2)13-11-12-14-28)18-25(4,5)23(35)41-20(3)17-27(7,37)29(30,31)32/h20-21,33,37H,9-19H2,1-8H3 |
| InChIKey | FZJRFBLJIPKLFP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|