C15H27NO4 — CID 118605253
(1-ethyl-4-nitrocycloheptyl) 2,2-dimethylbutanoate (PubChem CID 118605253) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is (1-ethyl-4-nitrocycloheptyl) 2,2-dimethylbutanoate.
| Compound Name | (1-ethyl-4-nitrocycloheptyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118605253 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (1-ethyl-4-nitrocycloheptyl) 2,2-dimethylbutanoate |
| SMILES | CCC1(OC(=O)C(C)(C)CC)CCCC([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H27NO4/c1-5-14(3,4)13(17)20-15(6-2)10-7-8-12(9-11-15)16(18)19/h12H,5-11H2,1-4H3 |
| InChIKey | XFDLHVBUPJVKOO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|