C12H26N2 — CID 118606012
1,4-ditert-butyl-2,2,3,3,5,5,6,6-octatritiopiperazine (PubChem CID 118606012) has the molecular formula C12H26N2 and a molecular weight of 214.42 g/mol. Its IUPAC name is 1,4-ditert-butyl-2,2,3,3,5,5,6,6-octatritiopiperazine.
| Compound Name | 1,4-ditert-butyl-2,2,3,3,5,5,6,6-octatritiopiperazine |
|---|---|
| PubChem CID | 118606012 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.28 |
| IUPAC Name | 1,4-ditert-butyl-2,2,3,3,5,5,6,6-octatritiopiperazine |
| SMILES | [3H]C1([3H])N(C(C)(C)C)C([3H])([3H])C([3H])([3H])N(C(C)(C)C)C1([3H])[3H] |
| InChI | InChI=1S/C12H26N2/c1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H2,1-6H3/i7T2,8T2,9T2,10T2 |
| InChIKey | SLRQZQPUXWCTDN-GKYVMOHGSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |