C9H14N2O3 — CID 118606284
N-(4-acetamidooxolan-3-yl)prop-2-enamide (PubChem CID 118606284) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is N-(4-acetamidooxolan-3-yl)prop-2-enamide.
| Compound Name | N-(4-acetamidooxolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 118606284 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | N-(4-acetamidooxolan-3-yl)prop-2-enamide |
| SMILES | C=CC(=O)NC1COCC1NC(C)=O |
| InChI | InChI=1S/C9H14N2O3/c1-3-9(13)11-8-5-14-4-7(8)10-6(2)12/h3,7-8H,1,4-5H2,2H3,(H,10,12)(H,11,13) |
| InChIKey | VALAGFUKDKZURN-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|