C7H12N2O2 — CID 90457526
N-[(3S,4R)-4-aminooxolan-3-yl]prop-2-enamide (PubChem CID 90457526) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is N-[(3S,4R)-4-aminooxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3S,4R)-4-aminooxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 90457526 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | N-[(3S,4R)-4-aminooxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1COC[C@@H]1N |
| InChI | InChI=1S/C7H12N2O2/c1-2-7(10)9-6-4-11-3-5(6)8/h2,5-6H,1,3-4,8H2,(H,9,10)/t5-,6+/m0/s1 |
| InChIKey | ZDBRNZWVVBFTQX-NTSWFWBYSA-N |
| XLogP | -0.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|