C8H14N2O2 — CID 118888267
N-[(3R,4S)-4-(methylamino)oxolan-3-yl]prop-2-enamide (PubChem CID 118888267) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is N-[(3R,4S)-4-(methylamino)oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-(methylamino)oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 118888267 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | N-[(3R,4S)-4-(methylamino)oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1NC |
| InChI | InChI=1S/C8H14N2O2/c1-3-8(11)10-7-5-12-4-6(7)9-2/h3,6-7,9H,1,4-5H2,2H3,(H,10,11)/t6-,7+/m1/s1 |
| InChIKey | NSBXJDKYEOFQSB-RQJHMYQMSA-N |
| XLogP | -0.72 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|