C6H7ClF2N2 — CID 118607014
(2,5-difluoro-4-pyridinyl)methanamine;hydrochloride (PubChem CID 118607014) has the molecular formula C6H7ClF2N2 and a molecular weight of 180.59 g/mol. Its IUPAC name is (2,5-difluoro-4-pyridinyl)methanamine;hydrochloride.
| Compound Name | (2,5-difluoro-4-pyridinyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 118607014 |
| Molecular Formula | C6H7ClF2N2 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | (2,5-difluoro-4-pyridinyl)methanamine;hydrochloride |
| SMILES | Cl.NCc1cc(F)ncc1F |
| InChI | InChI=1S/C6H6F2N2.ClH/c7-5-3-10-6(8)1-4(5)2-9;/h1,3H,2,9H2;1H |
| InChIKey | WKZBPPUWNAQWKY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|