C8H7FN2O — CID 117109985
(5-fluoro-1,2-benzoxazol-6-yl)methanamine (PubChem CID 117109985) has the molecular formula C8H7FN2O and a molecular weight of 166.15 g/mol. Its IUPAC name is (5-fluoro-1,2-benzoxazol-6-yl)methanamine.
| Compound Name | (5-fluoro-1,2-benzoxazol-6-yl)methanamine |
|---|---|
| PubChem CID | 117109985 |
| Molecular Formula | C8H7FN2O |
| Molecular Weight | 166.15 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (5-fluoro-1,2-benzoxazol-6-yl)methanamine |
| SMILES | NCc1cc2oncc2cc1F |
| InChI | InChI=1S/C8H7FN2O/c9-7-1-6-4-11-12-8(6)2-5(7)3-10/h1-2,4H,3,10H2 |
| InChIKey | JEZBNIMRXRIMNZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |