C12H16N4 — CID 118612825
5-cyclohexylpyrrolo[2,3-b]pyrazin-6-amine (PubChem CID 118612825) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is 5-cyclohexylpyrrolo[2,3-b]pyrazin-6-amine.
| Compound Name | 5-cyclohexylpyrrolo[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 118612825 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 5-cyclohexylpyrrolo[2,3-b]pyrazin-6-amine |
| SMILES | Nc1cc2nccnc2n1C1CCCCC1 |
| InChI | InChI=1S/C12H16N4/c13-11-8-10-12(15-7-6-14-10)16(11)9-4-2-1-3-5-9/h6-9H,1-5,13H2 |
| InChIKey | UUPQYFWVOVIEIF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |