C14H18ClN3O — CID 118618081
(2S)-7-chloro-1-cyclopentyl-2,4-dimethyl-2H-pyrido[3,4-b]pyrazin-3-one (PubChem CID 118618081) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is (2S)-7-chloro-1-cyclopentyl-2,4-dimethyl-2H-pyrido[3,4-b]pyrazin-3-one.
| Compound Name | (2S)-7-chloro-1-cyclopentyl-2,4-dimethyl-2H-pyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 118618081 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | (2S)-7-chloro-1-cyclopentyl-2,4-dimethyl-2H-pyrido[3,4-b]pyrazin-3-one |
| SMILES | C[C@H]1C(=O)N(C)c2cnc(Cl)cc2N1C1CCCC1 |
| InChI | InChI=1S/C14H18ClN3O/c1-9-14(19)17(2)12-8-16-13(15)7-11(12)18(9)10-5-3-4-6-10/h7-10H,3-6H2,1-2H3/t9-/m0/s1 |
| InChIKey | XGQIPGRZLMRDEZ-VIFPVBQESA-N |
| XLogP | 2.85 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|