C17H24ClN3O — CID 129237874
6-chloro-4-(4,4-dimethylcyclohexyl)-1,3-dimethyl-3H-pyrido[2,3-b]pyrazin-2-one (PubChem CID 129237874) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 6-chloro-4-(4,4-dimethylcyclohexyl)-1,3-dimethyl-3H-pyrido[2,3-b]pyrazin-2-one.
| Compound Name | 6-chloro-4-(4,4-dimethylcyclohexyl)-1,3-dimethyl-3H-pyrido[2,3-b]pyrazin-2-one |
|---|---|
| PubChem CID | 129237874 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-chloro-4-(4,4-dimethylcyclohexyl)-1,3-dimethyl-3H-pyrido[2,3-b]pyrazin-2-one |
| SMILES | CC1C(=O)N(C)c2ccc(Cl)nc2N1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C17H24ClN3O/c1-11-16(22)20(4)13-5-6-14(18)19-15(13)21(11)12-7-9-17(2,3)10-8-12/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | OOVDIKINRCTVML-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|