C21H18ClN3OS — CID 118619949
6-[5-[(3-chloro-2-pyridinyl)-sulfanylmethyl]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 118619949) has the molecular formula C21H18ClN3OS and a molecular weight of 395.92 g/mol. Its IUPAC name is 6-[5-[(3-chloro-2-pyridinyl)-sulfanylmethyl]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 6-[5-[(3-chloro-2-pyridinyl)-sulfanylmethyl]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 118619949 |
| Molecular Formula | C21H18ClN3OS |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 6-[5-[(3-chloro-2-pyridinyl)-sulfanylmethyl]-3-pyridinyl]-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(-c3cncc(C(S)c4ncccc4Cl)c3)ccc21 |
| InChI | InChI=1S/C21H18ClN3OS/c1-25-18-6-4-13(9-14(18)5-7-19(25)26)15-10-16(12-23-11-15)21(27)20-17(22)3-2-8-24-20/h2-4,6,8-12,21,27H,5,7H2,1H3 |
| InChIKey | JQILNQAYFUHWPE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|