C29H31F3N8O2 — CID 118620680
1-[4-[6-cyclopropyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide (PubChem CID 118620680) has the molecular formula C29H31F3N8O2 and a molecular weight of 580.62 g/mol. Its IUPAC name is 1-[4-[6-cyclopropyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-[4-[6-cyclopropyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 118620680 |
| Molecular Formula | C29H31F3N8O2 |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 1-[4-[6-cyclopropyl-5-(1,2,3,6-tetrahydropyridin-4-yl)-7H-pyrrolo[2,3-c]pyridazin-3-yl]butyl]-N-[[3-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
| SMILES | O=C(NCc1cccc(OC(F)(F)F)c1)c1cn(CCCCc2cc3c(C4=CCNCC4)c(C4CC4)[nH]c3nn2)nn1 |
| InChI | InChI=1S/C29H31F3N8O2/c30-29(31,32)42-22-6-3-4-18(14-22)16-34-28(41)24-17-40(39-37-24)13-2-1-5-21-15-23-25(19-9-11-33-12-10-19)26(20-7-8-20)35-27(23)38-36-21/h3-4,6,9,14-15,17,20,33H,1-2,5,7-8,10-13,16H2,(H,34,41)(H,35,38) |
| InChIKey | WCFUEEYKEOMMHZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 122.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|