C30H28F3N5O4 — CID 118622466
N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-4-pyridinyl]-2-phenylacetamide (PubChem CID 118622466) has the molecular formula C30H28F3N5O4 and a molecular weight of 579.58 g/mol. Its IUPAC name is N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-4-pyridinyl]-2-phenylacetamide.
| Compound Name | N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-4-pyridinyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 118622466 |
| Molecular Formula | C30H28F3N5O4 |
| Molecular Weight | 579.58 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | N-[2-oxo-1-[4-[6-[[2-[3-(trifluoromethoxy)phenyl]acetyl]amino]pyridazin-3-yl]butyl]-4-pyridinyl]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)Nc1ccn(CCCCc2ccc(NC(=O)Cc3cccc(OC(F)(F)F)c3)nn2)c(=O)c1 |
| InChI | InChI=1S/C30H28F3N5O4/c31-30(32,33)42-25-11-6-9-22(17-25)19-28(40)35-26-13-12-23(36-37-26)10-4-5-15-38-16-14-24(20-29(38)41)34-27(39)18-21-7-2-1-3-8-21/h1-3,6-9,11-14,16-17,20H,4-5,10,15,18-19H2,(H,34,39)(H,35,37,40) |
| InChIKey | GZWKNJQHHUEMTA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|