C15H19F2NO3 — CID 118627152
tert-butyl 2-[4-(3,3-difluorocyclobutyl)oxy-2-pyridinyl]acetate (PubChem CID 118627152) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is tert-butyl 2-[4-(3,3-difluorocyclobutyl)oxy-2-pyridinyl]acetate.
| Compound Name | tert-butyl 2-[4-(3,3-difluorocyclobutyl)oxy-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 118627152 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | tert-butyl 2-[4-(3,3-difluorocyclobutyl)oxy-2-pyridinyl]acetate |
| SMILES | CC(C)(C)OC(=O)Cc1cc(OC2CC(F)(F)C2)ccn1 |
| InChI | InChI=1S/C15H19F2NO3/c1-14(2,3)21-13(19)7-10-6-11(4-5-18-10)20-12-8-15(16,17)9-12/h4-6,12H,7-9H2,1-3H3 |
| InChIKey | ZXZSWAZSQQQWRU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |