C12H15NO2 — CID 146557427
[4-[[(5S)-3-bicyclo[3.1.0]hexanyl]oxy]-2-pyridinyl]methanol (PubChem CID 146557427) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is [4-[[(5S)-3-bicyclo[3.1.0]hexanyl]oxy]-2-pyridinyl]methanol.
| Compound Name | [4-[[(5S)-3-bicyclo[3.1.0]hexanyl]oxy]-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 146557427 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | [4-[[(5S)-3-bicyclo[3.1.0]hexanyl]oxy]-2-pyridinyl]methanol |
| SMILES | OCc1cc(OC2CC3C[C@H]3C2)ccn1 |
| InChI | InChI=1S/C12H15NO2/c14-7-10-6-11(1-2-13-10)15-12-4-8-3-9(8)5-12/h1-2,6,8-9,12,14H,3-5,7H2/t8-,9?,12?/m0/s1 |
| InChIKey | YYRJYMADRPFFAP-QTZUAFFRSA-N |
| XLogP | 1.75 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |