C9H8F5NO2 — CID 14902012
[4-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]methanol (PubChem CID 14902012) has the molecular formula C9H8F5NO2 and a molecular weight of 257.16 g/mol. Its IUPAC name is [4-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]methanol.
| Compound Name | [4-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 14902012 |
| Molecular Formula | C9H8F5NO2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | [4-(2,2,3,3,3-pentafluoropropoxy)-2-pyridinyl]methanol |
| SMILES | OCc1cc(OCC(F)(F)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C9H8F5NO2/c10-8(11,9(12,13)14)5-17-7-1-2-15-6(3-7)4-16/h1-3,16H,4-5H2 |
| InChIKey | NRTSYEPWJOCNDQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|