C15H21IN2O3 — CID 156738688
tert-butyl (2S,4R)-2-iodo-4-[(2-methyl-4-pyridinyl)oxy]pyrrolidine-1-carboxylate (PubChem CID 156738688) has the molecular formula C15H21IN2O3 and a molecular weight of 404.25 g/mol. Its IUPAC name is tert-butyl (2S,4R)-2-iodo-4-[(2-methyl-4-pyridinyl)oxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-2-iodo-4-[(2-methyl-4-pyridinyl)oxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156738688 |
| Molecular Formula | C15H21IN2O3 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 404.06 |
| IUPAC Name | tert-butyl (2S,4R)-2-iodo-4-[(2-methyl-4-pyridinyl)oxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(O[C@@H]2C[C@H](I)N(C(=O)OC(C)(C)C)C2)ccn1 |
| InChI | InChI=1S/C15H21IN2O3/c1-10-7-11(5-6-17-10)20-12-8-13(16)18(9-12)14(19)21-15(2,3)4/h5-7,12-13H,8-9H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | MDGXVDZIMUGXJL-CHWSQXEVSA-N |
| XLogP | 3.54 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|