C15H20F2N2O2 — CID 162385881
tert-butyl 3-[difluoro-(2-methyl-4-pyridinyl)methyl]azetidine-1-carboxylate (PubChem CID 162385881) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is tert-butyl 3-[difluoro-(2-methyl-4-pyridinyl)methyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[difluoro-(2-methyl-4-pyridinyl)methyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 162385881 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | tert-butyl 3-[difluoro-(2-methyl-4-pyridinyl)methyl]azetidine-1-carboxylate |
| SMILES | Cc1cc(C(F)(F)C2CN(C(=O)OC(C)(C)C)C2)ccn1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-10-7-11(5-6-18-10)15(16,17)12-8-19(9-12)13(20)21-14(2,3)4/h5-7,12H,8-9H2,1-4H3 |
| InChIKey | WALWMAJSJCPJFJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |