C10H7ClN2O3 — CID 118628740
(4-chloropyrimidin-5-yl)-[4-(hydroxymethyl)furan-2-yl]methanone (PubChem CID 118628740) has the molecular formula C10H7ClN2O3 and a molecular weight of 238.63 g/mol. Its IUPAC name is (4-chloropyrimidin-5-yl)-[4-(hydroxymethyl)furan-2-yl]methanone.
| Compound Name | (4-chloropyrimidin-5-yl)-[4-(hydroxymethyl)furan-2-yl]methanone |
|---|---|
| PubChem CID | 118628740 |
| Molecular Formula | C10H7ClN2O3 |
| Molecular Weight | 238.63 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | (4-chloropyrimidin-5-yl)-[4-(hydroxymethyl)furan-2-yl]methanone |
| SMILES | O=C(c1cc(CO)co1)c1cncnc1Cl |
| InChI | InChI=1S/C10H7ClN2O3/c11-10-7(2-12-5-13-10)9(15)8-1-6(3-14)4-16-8/h1-2,4-5,14H,3H2 |
| InChIKey | ZDWDHJRYMYULKR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.63 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |