C18H21N3O7S — CID 146747538
[(Z)-[(2S,4R)-2-hydroxy-4-[[5-[4-(hydroxymethyl)furan-2-carbonyl]pyrimidin-4-yl]amino]cyclopentylidene]methyl] ethanesulfonate (PubChem CID 146747538) has the molecular formula C18H21N3O7S and a molecular weight of 423.45 g/mol. Its IUPAC name is [(Z)-[(2S,4R)-2-hydroxy-4-[[5-[4-(hydroxymethyl)furan-2-carbonyl]pyrimidin-4-yl]amino]cyclopentylidene]methyl] ethanesulfonate.
| Compound Name | [(Z)-[(2S,4R)-2-hydroxy-4-[[5-[4-(hydroxymethyl)furan-2-carbonyl]pyrimidin-4-yl]amino]cyclopentylidene]methyl] ethanesulfonate |
|---|---|
| PubChem CID | 146747538 |
| Molecular Formula | C18H21N3O7S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | [(Z)-[(2S,4R)-2-hydroxy-4-[[5-[4-(hydroxymethyl)furan-2-carbonyl]pyrimidin-4-yl]amino]cyclopentylidene]methyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)O/C=C1/C[C@@H](Nc2ncncc2C(=O)c2cc(CO)co2)C[C@@H]1O |
| InChI | InChI=1S/C18H21N3O7S/c1-2-29(25,26)28-9-12-4-13(5-15(12)23)21-18-14(6-19-10-20-18)17(24)16-3-11(7-22)8-27-16/h3,6,8-10,13,15,22-23H,2,4-5,7H2,1H3,(H,19,20,21)/b12-9-/t13-,15+/m1/s1 |
| InChIKey | RMHKITOBOYGNNE-XHDTYXFFSA-N |
| XLogP | 0.98 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|