C23H27ClN4O4 — CID 118631621
3-[3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]oxyazetidin-1-yl]propanoic acid (PubChem CID 118631621) has the molecular formula C23H27ClN4O4 and a molecular weight of 458.95 g/mol. Its IUPAC name is 3-[3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]oxyazetidin-1-yl]propanoic acid.
| Compound Name | 3-[3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]oxyazetidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 118631621 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[3-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]oxyazetidin-1-yl]propanoic acid |
| SMILES | CCCCCn1c(OC2CN(CCC(=O)O)C2)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C23H27ClN4O4/c1-2-3-4-10-27-21(32-18-13-26(14-18)11-9-22(30)31)12-20(29)28-15-19(25-23(27)28)16-5-7-17(24)8-6-16/h5-8,12,15,18H,2-4,9-11,13-14H2,1H3,(H,30,31) |
| InChIKey | DMUPXYSMUKKSRZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|