C23H27ClN4O3 — CID 118631638
2-[(2R)-1-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidin-2-yl]acetic acid (PubChem CID 118631638) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 2-[(2R)-1-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidin-2-yl]acetic acid.
| Compound Name | 2-[(2R)-1-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 118631638 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 2-[(2R)-1-[2-(4-chlorophenyl)-5-oxo-8-pentylimidazo[1,2-a]pyrimidin-7-yl]pyrrolidin-2-yl]acetic acid |
| SMILES | CCCCCn1c(N2CCC[C@@H]2CC(=O)O)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C23H27ClN4O3/c1-2-3-4-11-27-20(26-12-5-6-18(26)13-22(30)31)14-21(29)28-15-19(25-23(27)28)16-7-9-17(24)10-8-16/h7-10,14-15,18H,2-6,11-13H2,1H3,(H,30,31)/t18-/m1/s1 |
| InChIKey | MSEXUWPSCFOQGQ-GOSISDBHSA-N |
| XLogP | 4.45 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|