About (1S)-1,5-diiodocyclododecane
(1S)-1,5-diiodocyclododecane (PubChem CID 118632109) has the molecular formula C12H22I2
and a molecular weight of 420.12 g/mol. Its IUPAC name is (1S)-1,5-diiodocyclododecane.
Molecular Properties
| Compound Name | (1S)-1,5-diiodocyclododecane |
| PubChem CID | 118632109 |
| Molecular Formula | C12H22I2 |
| Molecular Weight | 420.12 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | (1S)-1,5-diiodocyclododecane |
| SMILES | IC1CCCCCCC[C@H](I)CCC1 |
| InChI | InChI=1S/C12H22I2/c13-11-7-4-2-1-3-5-8-12(14)10-6-9-11/h11-12H,1-10H2/t11-,12?/m0/s1 |
| InChIKey | ZNGOHPRNPMPGQG-PXYINDEMSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.12 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1,5-diiodocyclododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1,5-diiodocyclododecane?
The IUPAC name of (1S)-1,5-diiodocyclododecane (CID 118632109) is (1S)-1,5-diiodocyclododecane.
What is the SMILES notation for (1S)-1,5-diiodocyclododecane?
The canonical SMILES for (1S)-1,5-diiodocyclododecane is IC1CCCCCCC[C@H](I)CCC1.
What is the InChIKey of (1S)-1,5-diiodocyclododecane?
The InChIKey is ZNGOHPRNPMPGQG-PXYINDEMSA-N. The full InChI is InChI=1S/C12H22I2/c13-11-7-4-2-1-3-5-8-12(14)10-6-9-11/h11-12H,1-10H2/t11-,12?/m0/s1.
What are the key properties of (1S)-1,5-diiodocyclododecane?
(1S)-1,5-diiodocyclododecane has a molecular weight of 420.12 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1,5-diiodocyclododecane is sourced from PubChem (CID 118632109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).