C15H10F4N5O2S- — CID 118632574
4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfinate (PubChem CID 118632574) has the molecular formula C15H10F4N5O2S- and a molecular weight of 400.34 g/mol. Its IUPAC name is 4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfinate.
| Compound Name | 4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfinate |
|---|---|
| PubChem CID | 118632574 |
| Molecular Formula | C15H10F4N5O2S- |
| Molecular Weight | 400.34 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 4-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfinate |
| SMILES | Nc1nc(Nc2cc(F)c(-c3ccc(S(=O)[O-])cc3)c(C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C15H11F4N5O2S/c16-11-6-8(21-14-22-13(20)23-24-14)5-10(15(17,18)19)12(11)7-1-3-9(4-2-7)27(25)26/h1-6H,(H,25,26)(H4,20,21,22,23,24)/p-1 |
| InChIKey | YHMBCUFDLFEZAX-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|