C15H11F4N5O3S — CID 141413835
3-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfonic acid (PubChem CID 141413835) has the molecular formula C15H11F4N5O3S and a molecular weight of 417.34 g/mol. Its IUPAC name is 3-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfonic acid.
| Compound Name | 3-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 141413835 |
| Molecular Formula | C15H11F4N5O3S |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 3-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]-2-fluoro-6-(trifluoromethyl)phenyl]benzenesulfonic acid |
| SMILES | Nc1nc(Nc2cc(F)c(-c3cccc(S(=O)(=O)O)c3)c(C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C15H11F4N5O3S/c16-11-6-8(21-14-22-13(20)23-24-14)5-10(15(17,18)19)12(11)7-2-1-3-9(4-7)28(25,26)27/h1-6H,(H,25,26,27)(H4,20,21,22,23,24) |
| InChIKey | RGZAHJIREHSRLA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 133.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|