C16H12F4N6 — CID 118632580
3-N-[3-fluoro-4-(4-methanimidoylphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 118632580) has the molecular formula C16H12F4N6 and a molecular weight of 364.31 g/mol. Its IUPAC name is 3-N-[3-fluoro-4-(4-methanimidoylphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-fluoro-4-(4-methanimidoylphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 118632580 |
| Molecular Formula | C16H12F4N6 |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-N-[3-fluoro-4-(4-methanimidoylphenyl)-5-(trifluoromethyl)phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | [H]/N=C/c1ccc(-c2c(F)cc(Nc3n[nH]c(N)n3)cc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H12F4N6/c17-12-6-10(23-15-24-14(22)25-26-15)5-11(16(18,19)20)13(12)9-3-1-8(7-21)2-4-9/h1-7,21H,(H4,22,23,24,25,26)/b21-7+ |
| InChIKey | VLJYPRZEIUUWLV-QPSGOUHRSA-N |
| XLogP | 3.95 |
| TPSA | 103.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|