C16H23NO2 — CID 118632817
2-(4-butoxyphenyl)-3,3-dimethylbutanenitrile oxide (PubChem CID 118632817) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-3,3-dimethylbutanenitrile oxide.
| Compound Name | 2-(4-butoxyphenyl)-3,3-dimethylbutanenitrile oxide |
|---|---|
| PubChem CID | 118632817 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 2-(4-butoxyphenyl)-3,3-dimethylbutanenitrile oxide |
| SMILES | CCCCOc1ccc(C(C#[N+][O-])C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-5-6-11-19-14-9-7-13(8-10-14)15(12-17-18)16(2,3)4/h7-10,15H,5-6,11H2,1-4H3 |
| InChIKey | HWKFKKIGGCACKP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 36.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|