C14H21FN2 — CID 118632947
5-tert-butyl-2-[[(3S)-3-fluoropyrrolidin-1-yl]methyl]pyridine (PubChem CID 118632947) has the molecular formula C14H21FN2 and a molecular weight of 236.33 g/mol. Its IUPAC name is 5-tert-butyl-2-[[(3S)-3-fluoropyrrolidin-1-yl]methyl]pyridine.
| Compound Name | 5-tert-butyl-2-[[(3S)-3-fluoropyrrolidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 118632947 |
| Molecular Formula | C14H21FN2 |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | 5-tert-butyl-2-[[(3S)-3-fluoropyrrolidin-1-yl]methyl]pyridine |
| SMILES | CC(C)(C)c1ccc(CN2CC[C@H](F)C2)nc1 |
| InChI | InChI=1S/C14H21FN2/c1-14(2,3)11-4-5-13(16-8-11)10-17-7-6-12(15)9-17/h4-5,8,12H,6-7,9-10H2,1-3H3/t12-/m0/s1 |
| InChIKey | VTDLZHGIUIIAEF-LBPRGKRZSA-N |
| XLogP | 2.92 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |