C20H14N2O — CID 118637558
4-[(1Z)-buta-1,3-dienyl]-6-dibenzofuran-2-ylpyrimidine (PubChem CID 118637558) has the molecular formula C20H14N2O and a molecular weight of 298.35 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-6-dibenzofuran-2-ylpyrimidine.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-6-dibenzofuran-2-ylpyrimidine |
|---|---|
| PubChem CID | 118637558 |
| Molecular Formula | C20H14N2O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-6-dibenzofuran-2-ylpyrimidine |
| SMILES | C=C/C=C\c1cc(-c2ccc3oc4ccccc4c3c2)ncn1 |
| InChI | InChI=1S/C20H14N2O/c1-2-3-6-15-12-18(22-13-21-15)14-9-10-20-17(11-14)16-7-4-5-8-19(16)23-20/h2-13H,1H2/b6-3- |
| InChIKey | KRJQUQWRVGNBHO-UTCJRWHESA-N |
| XLogP | 5.24 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|