C16H23F6NO9S2 — CID 118638203
1,1,2,2,3,3-hexafluoro-3-[3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid (PubChem CID 118638203) has the molecular formula C16H23F6NO9S2 and a molecular weight of 551.48 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118638203 |
| Molecular Formula | C16H23F6NO9S2 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[3-[2-(2-methylbutanoyloxy)ethoxycarbonyl]piperidin-1-yl]sulfonylpropane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)OCCOC(=O)C1CCCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)C1 |
| InChI | InChI=1S/C16H23F6NO9S2/c1-3-10(2)12(24)31-7-8-32-13(25)11-5-4-6-23(9-11)33(26,27)15(19,20)14(17,18)16(21,22)34(28,29)30/h10-11H,3-9H2,1-2H3,(H,28,29,30) |
| InChIKey | TUXLAARJVLYLAS-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 144.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|