C15H24F6N2O9S3 — CID 121354855
1,1,2,2,3,3-hexafluoro-3-[4-(3-hydroxy-5-methyl-4-oxoheptyl)sulfonylpiperazin-1-yl]sulfonylpropane-1-sulfonic acid (PubChem CID 121354855) has the molecular formula C15H24F6N2O9S3 and a molecular weight of 586.55 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-[4-(3-hydroxy-5-methyl-4-oxoheptyl)sulfonylpiperazin-1-yl]sulfonylpropane-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-[4-(3-hydroxy-5-methyl-4-oxoheptyl)sulfonylpiperazin-1-yl]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 121354855 |
| Molecular Formula | C15H24F6N2O9S3 |
| Molecular Weight | 586.55 g/mol |
| Exact Mass | 586.05 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-[4-(3-hydroxy-5-methyl-4-oxoheptyl)sulfonylpiperazin-1-yl]sulfonylpropane-1-sulfonic acid |
| SMILES | CCC(C)C(=O)C(O)CCS(=O)(=O)N1CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC1 |
| InChI | InChI=1S/C15H24F6N2O9S3/c1-3-10(2)12(25)11(24)4-9-33(26,27)22-5-7-23(8-6-22)34(28,29)14(18,19)13(16,17)15(20,21)35(30,31)32/h10-11,24H,3-9H2,1-2H3,(H,30,31,32) |
| InChIKey | UBECYQSGOHEAKP-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.55 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|