C16H16F6N2O6S2 — CID 58364141
3-[4-(4-ethenylbenzoyl)piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 58364141) has the molecular formula C16H16F6N2O6S2 and a molecular weight of 510.43 g/mol. Its IUPAC name is 3-[4-(4-ethenylbenzoyl)piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-[4-(4-ethenylbenzoyl)piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 58364141 |
| Molecular Formula | C16H16F6N2O6S2 |
| Molecular Weight | 510.43 g/mol |
| Exact Mass | 510.04 |
| IUPAC Name | 3-[4-(4-ethenylbenzoyl)piperazin-1-yl]sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | C=Cc1ccc(C(=O)N2CCN(S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O)CC2)cc1 |
| InChI | InChI=1S/C16H16F6N2O6S2/c1-2-11-3-5-12(6-4-11)13(25)23-7-9-24(10-8-23)31(26,27)15(19,20)14(17,18)16(21,22)32(28,29)30/h2-6H,1,7-10H2,(H,28,29,30) |
| InChIKey | JHBUZDQDMSNARB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|