C24H23N3O3S — CID 22628068
[4-(4-ethenylphenyl)sulfonylpiperazin-1-yl]-(4-pyridin-4-ylphenyl)methanone (PubChem CID 22628068) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is [4-(4-ethenylphenyl)sulfonylpiperazin-1-yl]-(4-pyridin-4-ylphenyl)methanone.
| Compound Name | [4-(4-ethenylphenyl)sulfonylpiperazin-1-yl]-(4-pyridin-4-ylphenyl)methanone |
|---|---|
| PubChem CID | 22628068 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [4-(4-ethenylphenyl)sulfonylpiperazin-1-yl]-(4-pyridin-4-ylphenyl)methanone |
| SMILES | C=Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc(-c4ccncc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H23N3O3S/c1-2-19-3-9-23(10-4-19)31(29,30)27-17-15-26(16-18-27)24(28)22-7-5-20(6-8-22)21-11-13-25-14-12-21/h2-14H,1,15-18H2 |
| InChIKey | ZZCMJRDWJIFUEH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |