C17H21NO3S2 — CID 118638360
2-[4-(methylamino)cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid (PubChem CID 118638360) has the molecular formula C17H21NO3S2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-[4-(methylamino)cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid.
| Compound Name | 2-[4-(methylamino)cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid |
|---|---|
| PubChem CID | 118638360 |
| Molecular Formula | C17H21NO3S2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-[4-(methylamino)cyclohexyl]oxy-2,2-dithiophen-2-ylacetic acid |
| SMILES | CNC1CCC(OC(C(=O)O)(c2cccs2)c2cccs2)CC1 |
| InChI | InChI=1S/C17H21NO3S2/c1-18-12-6-8-13(9-7-12)21-17(16(19)20,14-4-2-10-22-14)15-5-3-11-23-15/h2-5,10-13,18H,6-9H2,1H3,(H,19,20) |
| InChIKey | SYONGZHLUMTRHX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |