C16H20NO3P — CID 11864159
N-[(2-methoxyphenoxy)-methylphosphoryl]-3,4-dimethylaniline (PubChem CID 11864159) has the molecular formula C16H20NO3P and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[(2-methoxyphenoxy)-methylphosphoryl]-3,4-dimethylaniline.
| Compound Name | N-[(2-methoxyphenoxy)-methylphosphoryl]-3,4-dimethylaniline |
|---|---|
| PubChem CID | 11864159 |
| Molecular Formula | C16H20NO3P |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2-methoxyphenoxy)-methylphosphoryl]-3,4-dimethylaniline |
| SMILES | COc1ccccc1O[P@@](C)(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H20NO3P/c1-12-9-10-14(11-13(12)2)17-21(4,18)20-16-8-6-5-7-15(16)19-3/h5-11H,1-4H3,(H,17,18)/t21-/m1/s1 |
| InChIKey | UTFRWIOXBKGCTM-OAQYLSRUSA-N |
| XLogP | 4.63 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|