C22H24N6O3 — CID 118641797
N-[(1S,2R)-2-aminocyclohexyl]-2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118641797) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[(1S,2R)-2-aminocyclohexyl]-2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(1S,2R)-2-aminocyclohexyl]-2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118641797 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[(1S,2R)-2-aminocyclohexyl]-2-[3-(prop-2-enoylamino)phenoxy]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(Oc2cnc3[nH]cc(C(=O)N[C@H]4CCCC[C@H]4N)c3n2)c1 |
| InChI | InChI=1S/C22H24N6O3/c1-2-18(29)26-13-6-5-7-14(10-13)31-19-12-25-21-20(28-19)15(11-24-21)22(30)27-17-9-4-3-8-16(17)23/h2,5-7,10-12,16-17H,1,3-4,8-9,23H2,(H,24,25)(H,26,29)(H,27,30)/t16-,17+/m1/s1 |
| InChIKey | YSLFAUAHBGHKIS-SJORKVTESA-N |
| XLogP | 2.87 |
| TPSA | 135.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|