C50H40N2O2 — CID 118642786
[4-[1-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]-1-phenylethyl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol (PubChem CID 118642786) has the molecular formula C50H40N2O2 and a molecular weight of 700.88 g/mol. Its IUPAC name is [4-[1-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]-1-phenylethyl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol.
| Compound Name | [4-[1-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]-1-phenylethyl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol |
|---|---|
| PubChem CID | 118642786 |
| Molecular Formula | C50H40N2O2 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.31 |
| IUPAC Name | [4-[1-[4-methoxy-3-(1-phenyl-2-phenyliminoethenyl)phenyl]-1-phenylethyl]-2-(1-phenyl-2-phenyliminoethenyl)phenyl]methanol |
| SMILES | COc1ccc(C(C)(c2ccccc2)c2ccc(CO)c(C(=C=Nc3ccccc3)c3ccccc3)c2)cc1C(=C=Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C50H40N2O2/c1-50(40-22-12-5-13-23-40,41-29-28-39(36-53)45(32-41)47(37-18-8-3-9-19-37)34-51-43-24-14-6-15-25-43)42-30-31-49(54-2)46(33-42)48(38-20-10-4-11-21-38)35-52-44-26-16-7-17-27-44/h3-33,53H,36H2,1-2H3 |
| InChIKey | AHJDPPJQIAUABV-UHFFFAOYSA-N |
| XLogP | 11.41 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 11.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|