C40H39NO2 — CID 118642792
2,2-bis[2-methoxy-5-(2-phenylpropan-2-yl)phenyl]-N-phenylethenimine (PubChem CID 118642792) has the molecular formula C40H39NO2 and a molecular weight of 565.76 g/mol. Its IUPAC name is 2,2-bis[2-methoxy-5-(2-phenylpropan-2-yl)phenyl]-N-phenylethenimine.
| Compound Name | 2,2-bis[2-methoxy-5-(2-phenylpropan-2-yl)phenyl]-N-phenylethenimine |
|---|---|
| PubChem CID | 118642792 |
| Molecular Formula | C40H39NO2 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.30 |
| IUPAC Name | 2,2-bis[2-methoxy-5-(2-phenylpropan-2-yl)phenyl]-N-phenylethenimine |
| SMILES | COc1ccc(C(C)(C)c2ccccc2)cc1C(=C=Nc1ccccc1)c1cc(C(C)(C)c2ccccc2)ccc1OC |
| InChI | InChI=1S/C40H39NO2/c1-39(2,29-16-10-7-11-17-29)31-22-24-37(42-5)34(26-31)36(28-41-33-20-14-9-15-21-33)35-27-32(23-25-38(35)43-6)40(3,4)30-18-12-8-13-19-30/h7-27H,1-6H3 |
| InChIKey | BJHQGDIWEJSDNY-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|