About (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate
(tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate (PubChem CID 118645237) has the molecular formula C12H27O2PS
and a molecular weight of 266.39 g/mol. Its IUPAC name is (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate.
Molecular Properties
| Compound Name | (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate |
| PubChem CID | 118645237 |
| Molecular Formula | C12H27O2PS |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate |
| SMILES | CCP(CC)(CC)(CC)OC(=O)CCSC |
| InChI | InChI=1S/C12H27O2PS/c1-6-15(7-2,8-3,9-4)14-12(13)10-11-16-5/h6-11H2,1-5H3 |
| InChIKey | ZRRXFRWEIJFYAX-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate?
The IUPAC name of (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate (CID 118645237) is (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate.
What is the SMILES notation for (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate?
The canonical SMILES for (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate is CCP(CC)(CC)(CC)OC(=O)CCSC.
What is the InChIKey of (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate?
The InChIKey is ZRRXFRWEIJFYAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27O2PS/c1-6-15(7-2,8-3,9-4)14-12(13)10-11-16-5/h6-11H2,1-5H3.
What are the key properties of (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate?
(tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate has a molecular weight of 266.39 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (tetraethyl-λ5-phosphanyl) 3-methylsulfanylpropanoate is sourced from PubChem (CID 118645237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).